From: Sergey Skripnick Date: Tue, 30 Apr 2013 07:47:43 +0000 (+0300) Subject: Docstrings formatted according to pep257 X-Git-Url: https://review.fuel-infra.org/gitweb?a=commitdiff_plain;h=ee3bb94b247e79bcf0b735acb9341a89e289943c;p=openstack-build%2Fneutron-build.git Docstrings formatted according to pep257 Bug #1020184 quantum/plugins/cisco/* Change-Id: Ibb6a865a17de0ea4f1865972624e4c5da0e96b34 --- diff --git a/quantum/plugins/cisco/common/cisco_exceptions.py b/quantum/plugins/cisco/common/cisco_exceptions.py index de400582f..99504fcf0 100644 --- a/quantum/plugins/cisco/common/cisco_exceptions.py +++ b/quantum/plugins/cisco/common/cisco_exceptions.py @@ -17,9 +17,7 @@ # @author: Sumit Naiksatam, Cisco Systems, Inc. # @author: Rohit Agarwalla, Cisco Systems, Inc. -""" -Exceptions used by the Cisco plugin -""" +"""Exceptions used by the Cisco plugin.""" from quantum.common import exceptions diff --git a/quantum/plugins/cisco/common/cisco_faults.py b/quantum/plugins/cisco/common/cisco_faults.py index 2ffc984a0..9c3df2533 100644 --- a/quantum/plugins/cisco/common/cisco_faults.py +++ b/quantum/plugins/cisco/common/cisco_faults.py @@ -41,8 +41,9 @@ class Fault(webob.exc.HTTPException): @webob.dec.wsgify(RequestClass=wsgi.Request) def __call__(self, req): - """Generate a WSGI response based on the - exception passed to constructor. + """Generate a WSGI response. + + Response is generated based on the exception passed to constructor. """ # Replace the body with fault details. code = self.wrapped_exc.status_int @@ -60,7 +61,8 @@ class Fault(webob.exc.HTTPException): class PortNotFound(webob.exc.HTTPClientError): - """ + """PortNotFound exception. + subclass of :class:`~HTTPClientError` This indicates that the server did not find the port specified @@ -74,7 +76,8 @@ class PortNotFound(webob.exc.HTTPClientError): class CredentialNotFound(webob.exc.HTTPClientError): - """ + """CredentialNotFound exception. + subclass of :class:`~HTTPClientError` This indicates that the server did not find the Credential specified @@ -89,7 +92,8 @@ class CredentialNotFound(webob.exc.HTTPClientError): class QosNotFound(webob.exc.HTTPClientError): - """ + """QosNotFound exception. + subclass of :class:`~HTTPClientError` This indicates that the server did not find the QoS specified @@ -104,7 +108,8 @@ class QosNotFound(webob.exc.HTTPClientError): class NovatenantNotFound(webob.exc.HTTPClientError): - """ + """NovatenantNotFound exception. + subclass of :class:`~HTTPClientError` This indicates that the server did not find the Novatenant specified @@ -119,7 +124,8 @@ class NovatenantNotFound(webob.exc.HTTPClientError): class RequestedStateInvalid(webob.exc.HTTPClientError): - """ + """RequestedStateInvalid exception. + subclass of :class:`~HTTPClientError` This indicates that the server could not update the port state to diff --git a/quantum/plugins/cisco/common/cisco_utils.py b/quantum/plugins/cisco/common/cisco_utils.py index 7baa1d687..1fa04be21 100644 --- a/quantum/plugins/cisco/common/cisco_utils.py +++ b/quantum/plugins/cisco/common/cisco_utils.py @@ -26,9 +26,9 @@ LOG = logging.getLogger(__name__) def get16ByteUUID(uuid): - """ - Return a 16 byte has of the UUID, used when smaller unique - ID is required. + """Return first 16 bytes of UUID. + + Used when smaller unique ID is required. """ return hashlib.md5(uuid).hexdigest()[:16] diff --git a/quantum/plugins/cisco/common/config.py b/quantum/plugins/cisco/common/config.py index d9ad2a60f..a2feccb02 100644 --- a/quantum/plugins/cisco/common/config.py +++ b/quantum/plugins/cisco/common/config.py @@ -88,13 +88,14 @@ nexus_dictionary = {} class CiscoConfigOptions(): """Cisco Configuration Options Class.""" + def __init__(self): self._create_nexus_dictionary() def _create_nexus_dictionary(self): - """ - Create the Nexus dictionary from the cisco_plugins.ini - NEXUS_SWITCH section(s). + """Create the Nexus dictionary. + + Reads data from cisco_plugins.ini NEXUS_SWITCH section(s). """ for parsed_file in cfg.CONF._cparser.parsed: for parsed_item in parsed_file.keys(): diff --git a/quantum/plugins/cisco/db/api.py b/quantum/plugins/cisco/db/api.py index 7b3018971..7835fbd5b 100644 --- a/quantum/plugins/cisco/db/api.py +++ b/quantum/plugins/cisco/db/api.py @@ -30,9 +30,10 @@ BASE = models.BASE def configure_db(options): - """ - Establish the database, create an engine if needed, and - register the models. + """Configure database. + + Establish the database, create an engine if needed, and register the + models. :param options: Mapping of configuration options """ diff --git a/quantum/plugins/cisco/db/l2network_models.py b/quantum/plugins/cisco/db/l2network_models.py index e39ef1e68..da46777b8 100644 --- a/quantum/plugins/cisco/db/l2network_models.py +++ b/quantum/plugins/cisco/db/l2network_models.py @@ -24,6 +24,7 @@ from quantum.plugins.cisco.db.models import BASE class L2NetworkBase(object): """Base class for L2Network Models.""" + __table_args__ = {'mysql_engine': 'InnoDB'} def __setitem__(self, key, value): @@ -54,7 +55,8 @@ class L2NetworkBase(object): setattr(self, k, v) def iteritems(self): - """Make the model object behave like a dict" + """Make the model object behave like a dict. + Includes attributes from joins. """ local = dict(self) @@ -66,6 +68,7 @@ class L2NetworkBase(object): class VlanID(BASE, L2NetworkBase): """Represents a vlan_id usage.""" + __tablename__ = 'vlan_ids' vlan_id = Column(Integer, primary_key=True) @@ -81,6 +84,7 @@ class VlanID(BASE, L2NetworkBase): class VlanBinding(BASE, L2NetworkBase): """Represents a binding of vlan_id to network_id.""" + __tablename__ = 'vlan_bindings' vlan_id = Column(Integer, primary_key=True) @@ -101,6 +105,7 @@ class VlanBinding(BASE, L2NetworkBase): class QoS(BASE, L2NetworkBase): """Represents QoS for a tenant.""" + __tablename__ = 'qoss' qos_id = Column(String(255)) @@ -121,6 +126,7 @@ class QoS(BASE, L2NetworkBase): class Credential(BASE, L2NetworkBase): """Represents credentials for a tenant.""" + __tablename__ = 'credentials' credential_id = Column(String(255)) diff --git a/quantum/plugins/cisco/db/models.py b/quantum/plugins/cisco/db/models.py index 82062a659..9308347d2 100644 --- a/quantum/plugins/cisco/db/models.py +++ b/quantum/plugins/cisco/db/models.py @@ -30,6 +30,7 @@ BASE = declarative_base() class QuantumBase(object): """Base class for Quantum Models.""" + __table_args__ = {'mysql_engine': 'InnoDB'} def __setitem__(self, key, value): @@ -56,6 +57,7 @@ class QuantumBase(object): def iteritems(self): """Make the model object behave like a dict. + Includes attributes from joins. """ local = dict(self) @@ -67,6 +69,7 @@ class QuantumBase(object): class Port(BASE, QuantumBase): """Represents a port on a quantum network.""" + __tablename__ = 'ports' uuid = Column(String(255), primary_key=True) @@ -88,6 +91,7 @@ class Port(BASE, QuantumBase): class Network(BASE, QuantumBase): """Represents a quantum network.""" + __tablename__ = 'networks' uuid = Column(String(255), primary_key=True) diff --git a/quantum/plugins/cisco/db/network_models_v2.py b/quantum/plugins/cisco/db/network_models_v2.py index fadbbfef8..a70863e7f 100644 --- a/quantum/plugins/cisco/db/network_models_v2.py +++ b/quantum/plugins/cisco/db/network_models_v2.py @@ -26,6 +26,7 @@ from quantum.openstack.common import uuidutils class L2NetworkBase(object): """Base class for L2Network Models.""" + #__table_args__ = {'mysql_engine': 'InnoDB'} def __setitem__(self, key, value): @@ -56,7 +57,8 @@ class L2NetworkBase(object): setattr(self, k, v) def iteritems(self): - """Make the model object behave like a dict" + """Make the model object behave like a dict. + Includes attributes from joins. """ local = dict(self) @@ -103,6 +105,7 @@ class Vlan_Binding(model_base.BASEV2, L2NetworkBase): class QoS(model_base.BASEV2, L2NetworkBase): """Represents QoS for a tenant.""" + __tablename__ = 'qoss' qos_id = Column(String(255)) @@ -123,6 +126,7 @@ class QoS(model_base.BASEV2, L2NetworkBase): class Credential(model_base.BASEV2, L2NetworkBase): """Represents credentials for a tenant.""" + __tablename__ = 'credentials' credential_id = Column(String(255)) diff --git a/quantum/plugins/cisco/db/nexus_models_v2.py b/quantum/plugins/cisco/db/nexus_models_v2.py index e787c4c86..72da1445e 100644 --- a/quantum/plugins/cisco/db/nexus_models_v2.py +++ b/quantum/plugins/cisco/db/nexus_models_v2.py @@ -23,6 +23,7 @@ from quantum.plugins.cisco.db.l2network_models import L2NetworkBase class NexusPortBinding(model_base.BASEV2, L2NetworkBase): """Represents a binding of VM's to nexus ports.""" + __tablename__ = "nexusport_bindings" id = Column(Integer, primary_key=True, autoincrement=True) diff --git a/quantum/plugins/cisco/extensions/_credential_view.py b/quantum/plugins/cisco/extensions/_credential_view.py index 4456a7378..04eea64e1 100644 --- a/quantum/plugins/cisco/extensions/_credential_view.py +++ b/quantum/plugins/cisco/extensions/_credential_view.py @@ -19,18 +19,16 @@ def get_view_builder(req): - """get view builder.""" base_url = req.application_url return ViewBuilder(base_url) class ViewBuilder(object): - """ - ViewBuilder for Credential, - derived from quantum.views.networks - """ + """ViewBuilder for Credential, derived from quantum.views.networks.""" + def __init__(self, base_url): - """ + """Initialize builder. + :param base_url: url of the root wsgi application """ self.base_url = base_url diff --git a/quantum/plugins/cisco/extensions/_qos_view.py b/quantum/plugins/cisco/extensions/_qos_view.py index 06d8e3178..93472adae 100644 --- a/quantum/plugins/cisco/extensions/_qos_view.py +++ b/quantum/plugins/cisco/extensions/_qos_view.py @@ -19,18 +19,16 @@ def get_view_builder(req): - """get view builder.""" base_url = req.application_url return ViewBuilder(base_url) class ViewBuilder(object): - """ - ViewBuilder for QoS, - derived from quantum.views.networks - """ + """ViewBuilder for QoS, derived from quantum.views.networks.""" + def __init__(self, base_url): - """ + """Initialize builder. + :param base_url: url of the root wsgi application """ self.base_url = base_url diff --git a/quantum/plugins/cisco/extensions/credential.py b/quantum/plugins/cisco/extensions/credential.py index b9d53fc65..c72740780 100644 --- a/quantum/plugins/cisco/extensions/credential.py +++ b/quantum/plugins/cisco/extensions/credential.py @@ -31,7 +31,7 @@ from quantum import wsgi class Credential(extensions.ExtensionDescriptor): - """extension class Credential.""" + """Extension class Credential.""" @classmethod def get_name(cls): diff --git a/quantum/plugins/cisco/l2device_plugin_base.py b/quantum/plugins/cisco/l2device_plugin_base.py index 7e8ff53f7..610f550b1 100644 --- a/quantum/plugins/cisco/l2device_plugin_base.py +++ b/quantum/plugins/cisco/l2device_plugin_base.py @@ -21,8 +21,8 @@ import inspect class L2DevicePluginBase(object): - """ - Base class for a device-specific plugin. + """Base class for a device-specific plugin. + An example of a device-specific plugin is a Nexus switch plugin. The network model relies on device-category-specific plugins to perform the configuration on each device. @@ -32,7 +32,8 @@ class L2DevicePluginBase(object): @abstractmethod def get_all_networks(self, tenant_id, **kwargs): - """ + """Get newtorks. + :returns: :raises: """ @@ -41,7 +42,8 @@ class L2DevicePluginBase(object): @abstractmethod def create_network(self, tenant_id, net_name, net_id, vlan_name, vlan_id, **kwargs): - """ + """Create network. + :returns: :raises: """ @@ -49,7 +51,8 @@ class L2DevicePluginBase(object): @abstractmethod def delete_network(self, tenant_id, net_id, **kwargs): - """ + """Delete network. + :returns: :raises: """ @@ -57,7 +60,8 @@ class L2DevicePluginBase(object): @abstractmethod def get_network_details(self, tenant_id, net_id, **kwargs): - """ + """Get network details. + :returns: :raises: """ @@ -65,7 +69,8 @@ class L2DevicePluginBase(object): @abstractmethod def update_network(self, tenant_id, net_id, name, **kwargs): - """ + """Update network. + :returns: :raises: """ @@ -73,7 +78,8 @@ class L2DevicePluginBase(object): @abstractmethod def get_all_ports(self, tenant_id, net_id, **kwargs): - """ + """Get ports. + :returns: :raises: """ @@ -81,7 +87,8 @@ class L2DevicePluginBase(object): @abstractmethod def create_port(self, tenant_id, net_id, port_state, port_id, **kwargs): - """ + """Create port. + :returns: :raises: """ @@ -89,7 +96,8 @@ class L2DevicePluginBase(object): @abstractmethod def delete_port(self, tenant_id, net_id, port_id, **kwargs): - """ + """Delete port. + :returns: :raises: """ @@ -97,7 +105,8 @@ class L2DevicePluginBase(object): @abstractmethod def update_port(self, tenant_id, net_id, port_id, **kwargs): - """ + """Update port. + :returns: :raises: """ @@ -105,7 +114,8 @@ class L2DevicePluginBase(object): @abstractmethod def get_port_details(self, tenant_id, net_id, port_id, **kwargs): - """ + """Get port details. + :returns: :raises: """ @@ -114,7 +124,8 @@ class L2DevicePluginBase(object): @abstractmethod def plug_interface(self, tenant_id, net_id, port_id, remote_interface_id, **kwargs): - """ + """Plug interface. + :returns: :raises: """ @@ -122,7 +133,8 @@ class L2DevicePluginBase(object): @abstractmethod def unplug_interface(self, tenant_id, net_id, port_id, **kwargs): - """ + """Unplug interface. + :returns: :raises: """ @@ -130,35 +142,40 @@ class L2DevicePluginBase(object): def create_subnet(self, tenant_id, net_id, ip_version, subnet_cidr, **kwargs): - """ + """Create subnet. + :returns: :raises: """ pass def get_subnets(self, tenant_id, net_id, **kwargs): - """ + """Get subnets. + :returns: :raises: """ pass def get_subnet(self, tenant_id, net_id, subnet_id, **kwargs): - """ + """Get subnet. + :returns: :raises: """ pass def update_subnet(self, tenant_id, net_id, subnet_id, **kwargs): - """ + """Update subnet. + :returns: :raises: """ pass def delete_subnet(self, tenant_id, net_id, subnet_id, **kwargs): - """ + """Delete subnet. + :returns: :raises: """ @@ -166,7 +183,8 @@ class L2DevicePluginBase(object): @classmethod def __subclasshook__(cls, klass): - """ + """Check plugin class. + The __subclasshook__ method is a class method that will be called everytime a class is tested using issubclass(klass, Plugin). diff --git a/quantum/plugins/cisco/models/virt_phy_sw_v2.py b/quantum/plugins/cisco/models/virt_phy_sw_v2.py index 7fe00daa0..2938608ea 100644 --- a/quantum/plugins/cisco/models/virt_phy_sw_v2.py +++ b/quantum/plugins/cisco/models/virt_phy_sw_v2.py @@ -40,7 +40,8 @@ LOG = logging.getLogger(__name__) class VirtualPhysicalSwitchModelV2(quantum_plugin_base_v2.QuantumPluginBaseV2): - """ + """Virtual Physical Switch Model. + This implementation works with OVS and Nexus plugin for the following topology: One or more servers to a nexus switch. @@ -58,10 +59,10 @@ class VirtualPhysicalSwitchModelV2(quantum_plugin_base_v2.QuantumPluginBaseV2): 'get_subnet', 'get_subnets', ] def __init__(self): - """ - Initialize the segmentation manager, check which device plugins are - configured, and load the inventories those device plugins for which the - inventory is configured + """Initialize the segmentation manager. + + Checks which device plugins are configured, and load the inventories + those device plugins for which the inventory is configured. """ conf.CiscoConfigOptions() @@ -90,7 +91,8 @@ class VirtualPhysicalSwitchModelV2(quantum_plugin_base_v2.QuantumPluginBaseV2): 'name': self.__class__.__name__}) def __getattribute__(self, name): - """ + """Delegate calls to OVS sub-plugin. + This delegates the calls to the methods implemented only by the OVS sub-plugin. Note: Currently, bulking is handled by the caller (PluginV2), and this model class expects to receive only non-bulking @@ -118,7 +120,8 @@ class VirtualPhysicalSwitchModelV2(quantum_plugin_base_v2.QuantumPluginBaseV2): return func_name def _invoke_plugin_per_device(self, plugin_key, function_name, args): - """ + """Invoke plugin per device. + Invokes a device plugin's relevant functions (based on the plugin implementation) for completing this operation. """ @@ -135,7 +138,8 @@ class VirtualPhysicalSwitchModelV2(quantum_plugin_base_v2.QuantumPluginBaseV2): device_params)] def _invoke_plugin(self, plugin_key, function_name, args, kwargs): - """ + """Invoke plugin. + Invokes the relevant function on a device plugin's implementation for completing this operation. """ @@ -189,7 +193,8 @@ class VirtualPhysicalSwitchModelV2(quantum_plugin_base_v2.QuantumPluginBaseV2): return host def create_network(self, context, network): - """ + """Create network. + Perform this operation in the context of the configured device plugins. """ @@ -213,7 +218,8 @@ class VirtualPhysicalSwitchModelV2(quantum_plugin_base_v2.QuantumPluginBaseV2): raise def update_network(self, context, id, network): - """ + """Update network. + Perform this operation in the context of the configured device plugins. """ @@ -235,7 +241,8 @@ class VirtualPhysicalSwitchModelV2(quantum_plugin_base_v2.QuantumPluginBaseV2): return ovs_output[0] def delete_network(self, context, id): - """ + """Delete network. + Perform this operation in the context of the configured device plugins. """ @@ -286,7 +293,8 @@ class VirtualPhysicalSwitchModelV2(quantum_plugin_base_v2.QuantumPluginBaseV2): return nexus_output def create_port(self, context, port): - """ + """Create port. + Perform this operation in the context of the configured device plugins. """ @@ -323,7 +331,8 @@ class VirtualPhysicalSwitchModelV2(quantum_plugin_base_v2.QuantumPluginBaseV2): pass def update_port(self, context, id, port): - """ + """Update port. + Perform this operation in the context of the configured device plugins. """ @@ -354,7 +363,8 @@ class VirtualPhysicalSwitchModelV2(quantum_plugin_base_v2.QuantumPluginBaseV2): raise def delete_port(self, context, id): - """ + """Delete port. + Perform this operation in the context of the configured device plugins. """ diff --git a/quantum/plugins/cisco/network_plugin.py b/quantum/plugins/cisco/network_plugin.py index 9c14c5bb3..187505540 100644 --- a/quantum/plugins/cisco/network_plugin.py +++ b/quantum/plugins/cisco/network_plugin.py @@ -34,9 +34,8 @@ LOG = logging.getLogger(__name__) class PluginV2(db_base_plugin_v2.QuantumDbPluginV2): - """ - Meta-Plugin with v2 API support for multiple sub-plugins. - """ + """Meta-Plugin with v2 API support for multiple sub-plugins.""" + supported_extension_aliases = ["Cisco Credential", "Cisco qos"] _methods_to_delegate = ['create_network', 'delete_network', 'update_network', 'get_network', @@ -49,9 +48,7 @@ class PluginV2(db_base_plugin_v2.QuantumDbPluginV2): _master = True def __init__(self): - """ - Loads the model class. - """ + """Load the model class.""" self._model = importutils.import_object(config.CISCO.model_class) if hasattr(self._model, "MANAGE_STATE") and self._model.MANAGE_STATE: self._master = False @@ -68,7 +65,8 @@ class PluginV2(db_base_plugin_v2.QuantumDbPluginV2): LOG.debug(_("Plugin initialization complete")) def __getattribute__(self, name): - """ + """Delegate core API calls to the model class. + When the configured model class offers to manage the state of the logical resources, we delegate the core API calls directly to it. Note: Bulking calls will be handled by this class, and turned into @@ -83,7 +81,8 @@ class PluginV2(db_base_plugin_v2.QuantumDbPluginV2): return object.__getattribute__(self, name) def __getattr__(self, name): - """ + """Delegate calls to the extensions. + This delegates the calls to the extensions explicitly implemented by the model. """ @@ -99,10 +98,7 @@ class PluginV2(db_base_plugin_v2.QuantumDbPluginV2): Core API implementation """ def create_network(self, context, network): - """ - Creates a new Virtual Network, and assigns it - a symbolic name. - """ + """Create new Virtual Network, and assigns it a symbolic name.""" LOG.debug(_("create_network() called")) new_network = super(PluginV2, self).create_network(context, network) @@ -116,9 +112,9 @@ class PluginV2(db_base_plugin_v2.QuantumDbPluginV2): raise def update_network(self, context, id, network): - """ - Updates the symbolic name belonging to a particular - Virtual Network. + """Update network. + + Updates the symbolic name belonging to a particular Virtual Network. """ LOG.debug(_("update_network() called")) upd_net_dict = super(PluginV2, self).update_network(context, id, @@ -128,7 +124,8 @@ class PluginV2(db_base_plugin_v2.QuantumDbPluginV2): return upd_net_dict def delete_network(self, context, id): - """ + """Delete network. + Deletes the network with the specified network identifier belonging to the specified tenant. """ @@ -157,23 +154,17 @@ class PluginV2(db_base_plugin_v2.QuantumDbPluginV2): raise def get_network(self, context, id, fields=None): - """ - Gets a particular network - """ + """Get a particular network.""" LOG.debug(_("get_network() called")) return super(PluginV2, self).get_network(context, id, fields) def get_networks(self, context, filters=None, fields=None): - """ - Gets all networks - """ + """Get all networks.""" LOG.debug(_("get_networks() called")) return super(PluginV2, self).get_networks(context, filters, fields) def create_port(self, context, port): - """ - Creates a port on the specified Virtual Network. - """ + """Create a port on the specified Virtual Network.""" LOG.debug(_("create_port() called")) new_port = super(PluginV2, self).create_port(context, port) try: @@ -184,18 +175,16 @@ class PluginV2(db_base_plugin_v2.QuantumDbPluginV2): raise def delete_port(self, context, id): - """ - Deletes a port - """ LOG.debug(_("delete_port() called")) port = self._get_port(context, id) - """ + """Delete port. + TODO (Sumit): Disabling this check for now, check later - #Allow deleting a port only if the administrative state is down, - #and its operation status is also down - if port['admin_state_up'] or port['status'] == 'ACTIVE': - raise exc.PortInUse(port_id=id, net_id=port['network_id'], - att_id=port['device_id']) + Allow deleting a port only if the administrative state is down, + and its operation status is also down + #if port['admin_state_up'] or port['status'] == 'ACTIVE': + # raise exc.PortInUse(port_id=id, net_id=port['network_id'], + # att_id=port['device_id']) """ try: kwargs = {const.PORT: port} @@ -207,9 +196,7 @@ class PluginV2(db_base_plugin_v2.QuantumDbPluginV2): raise def update_port(self, context, id, port): - """ - Updates the state of a port and returns the updated port - """ + """Update the state of a port and return the updated port.""" LOG.debug(_("update_port() called")) try: self._invoke_device_plugins(self._func_name(), [context, id, @@ -219,7 +206,8 @@ class PluginV2(db_base_plugin_v2.QuantumDbPluginV2): raise def create_subnet(self, context, subnet): - """ + """Create subnet. + Create a subnet, which represents a range of IP addresses that can be allocated to devices. """ @@ -234,9 +222,7 @@ class PluginV2(db_base_plugin_v2.QuantumDbPluginV2): raise def update_subnet(self, context, id, subnet): - """ - Updates the state of a subnet and returns the updated subnet - """ + """Updates the state of a subnet and returns the updated subnet.""" LOG.debug(_("update_subnet() called")) try: self._invoke_device_plugins(self._func_name(), [context, id, @@ -246,9 +232,6 @@ class PluginV2(db_base_plugin_v2.QuantumDbPluginV2): raise def delete_subnet(self, context, id): - """ - Deletes a subnet - """ LOG.debug(_("delete_subnet() called")) with context.session.begin(): subnet = self._get_subnet(context, id) @@ -372,8 +355,9 @@ class PluginV2(db_base_plugin_v2.QuantumDbPluginV2): return host_list def associate_port(self, tenant_id, instance_id, instance_desc): - """ - Get the portprofile name and the device name for the dynamic vnic + """Associate port. + + Get the portprofile name and the device name for the dynamic vnic. """ LOG.debug(_("associate_port() called")) return self._invoke_device_plugins(self._func_name(), [tenant_id, @@ -381,9 +365,7 @@ class PluginV2(db_base_plugin_v2.QuantumDbPluginV2): instance_desc]) def detach_port(self, tenant_id, instance_id, instance_desc): - """ - Remove the association of the VIF with the dynamic vnic - """ + """Remove the association of the VIF with the dynamic vnic.""" LOG.debug(_("detach_port() called")) return self._invoke_device_plugins(self._func_name(), [tenant_id, instance_id, @@ -393,9 +375,9 @@ class PluginV2(db_base_plugin_v2.QuantumDbPluginV2): Private functions """ def _invoke_device_plugins(self, function_name, args): - """ - Device-specific calls including core API and extensions are - delegated to the model. + """Device-specific calls. + + Including core API and extensions are delegated to the model. """ if hasattr(self._model, function_name): return getattr(self._model, function_name)(*args) diff --git a/quantum/plugins/cisco/nexus/cisco_nexus_network_driver_v2.py b/quantum/plugins/cisco/nexus/cisco_nexus_network_driver_v2.py index a710531f9..82452742c 100644 --- a/quantum/plugins/cisco/nexus/cisco_nexus_network_driver_v2.py +++ b/quantum/plugins/cisco/nexus/cisco_nexus_network_driver_v2.py @@ -33,66 +33,56 @@ LOG = logging.getLogger(__name__) class CiscoNEXUSDriver(): - """ - Nexus Driver Main Class - """ + """Nexus Driver Main Class.""" def __init__(self): pass def nxos_connect(self, nexus_host, nexus_ssh_port, nexus_user, nexus_password): - """ - Makes the SSH connection to the Nexus Switch - """ + """Make SSH connection to the Nexus Switch.""" man = manager.connect(host=nexus_host, port=nexus_ssh_port, username=nexus_user, password=nexus_password) return man def create_xml_snippet(self, cutomized_config): - """ - Creates the Proper XML structure for the Nexus Switch Configuration + """Create XML snippet. + + Creates the Proper XML structure for the Nexus Switch Configuration. """ conf_xml_snippet = snipp.EXEC_CONF_SNIPPET % (cutomized_config) return conf_xml_snippet def enable_vlan(self, mgr, vlanid, vlanname): - """ - Creates a VLAN on Nexus Switch given the VLAN ID and Name - """ + """Creates a VLAN on Nexus Switch given the VLAN ID and Name.""" confstr = snipp.CMD_VLAN_CONF_SNIPPET % (vlanid, vlanname) confstr = self.create_xml_snippet(confstr) mgr.edit_config(target='running', config=confstr) def disable_vlan(self, mgr, vlanid): - """ - Delete a VLAN on Nexus Switch given the VLAN ID - """ + """Delete a VLAN on Nexus Switch given the VLAN ID.""" confstr = snipp.CMD_NO_VLAN_CONF_SNIPPET % vlanid confstr = self.create_xml_snippet(confstr) mgr.edit_config(target='running', config=confstr) def enable_port_trunk(self, mgr, interface): - """ - Enables trunk mode an interface on Nexus Switch - """ + """Enable trunk mode an interface on Nexus Switch.""" confstr = snipp.CMD_PORT_TRUNK % (interface) confstr = self.create_xml_snippet(confstr) LOG.debug(_("NexusDriver: %s"), confstr) mgr.edit_config(target='running', config=confstr) def disable_switch_port(self, mgr, interface): - """ - Disables trunk mode an interface on Nexus Switch - """ + """Disable trunk mode an interface on Nexus Switch.""" confstr = snipp.CMD_NO_SWITCHPORT % (interface) confstr = self.create_xml_snippet(confstr) LOG.debug(_("NexusDriver: %s"), confstr) mgr.edit_config(target='running', config=confstr) def enable_vlan_on_trunk_int(self, mgr, interface, vlanid): - """ + """Enable vlan in trunk interface. + Enables trunk mode vlan access an interface on Nexus Switch given - VLANID + VLANID. """ confstr = snipp.CMD_VLAN_INT_SNIPPET % (interface, vlanid) confstr = self.create_xml_snippet(confstr) @@ -100,9 +90,10 @@ class CiscoNEXUSDriver(): mgr.edit_config(target='running', config=confstr) def disable_vlan_on_trunk_int(self, mgr, interface, vlanid): - """ - Enables trunk mode vlan access an interface on Nexus Switch given - VLANID + """Disable VLAN. + + Disables trunk mode vlan access an interface on Nexus Switch given + VLANID. """ confstr = snipp.CMD_NO_VLAN_INT_SNIPPET % (interface, vlanid) confstr = self.create_xml_snippet(confstr) @@ -112,9 +103,10 @@ class CiscoNEXUSDriver(): def create_vlan(self, vlan_name, vlan_id, nexus_host, nexus_user, nexus_password, nexus_ports, nexus_ssh_port, vlan_ids=None): - """ + """Create VLAN and enablt in on the interface. + Creates a VLAN and Enable on trunk mode an interface on Nexus Switch - given the VLAN ID and Name and Interface Number + given the VLAN ID and Name and Interface Number. """ man = self.nxos_connect(nexus_host, int(nexus_ssh_port), nexus_user, nexus_password) @@ -127,9 +119,10 @@ class CiscoNEXUSDriver(): def delete_vlan(self, vlan_id, nexus_host, nexus_user, nexus_password, nexus_ports, nexus_ssh_port): - """ + """Delete vlan. + Delete a VLAN and Disables trunk mode an interface on Nexus Switch - given the VLAN ID and Interface Number + given the VLAN ID and Interface Number. """ man = self.nxos_connect(nexus_host, int(nexus_ssh_port), nexus_user, nexus_password) @@ -138,9 +131,7 @@ class CiscoNEXUSDriver(): self.disable_vlan_on_trunk_int(man, ports, vlan_id) def build_vlans_cmd(self): - """ - Builds a string with all the VLANs on the same Switch - """ + """Builds a string with all the VLANs on the same Switch.""" assigned_vlan = cdb.get_all_vlanids_used() vlans = '' for vlanid in assigned_vlan: @@ -151,8 +142,9 @@ class CiscoNEXUSDriver(): def add_vlan_int(self, vlan_id, nexus_host, nexus_user, nexus_password, nexus_ports, nexus_ssh_port, vlan_ids=None): - """ - Adds a vlan from interfaces on the Nexus switch given the VLAN ID + """Add vlan. + + Adds a vlan from interfaces on the Nexus switch given the VLAN ID. """ man = self.nxos_connect(nexus_host, int(nexus_ssh_port), nexus_user, nexus_password) @@ -163,8 +155,9 @@ class CiscoNEXUSDriver(): def remove_vlan_int(self, vlan_id, nexus_host, nexus_user, nexus_password, nexus_ports, nexus_ssh_port): - """ - Removes a vlan from interfaces on the Nexus switch given the VLAN ID + """Remove vlan. + + Removes a vlan from interfaces on the Nexus switch given the VLAN ID. """ man = self.nxos_connect(nexus_host, int(nexus_ssh_port), nexus_user, nexus_password) diff --git a/quantum/plugins/cisco/nexus/cisco_nexus_plugin_v2.py b/quantum/plugins/cisco/nexus/cisco_nexus_plugin_v2.py index 6c8f7034c..0cb0ae010 100644 --- a/quantum/plugins/cisco/nexus/cisco_nexus_plugin_v2.py +++ b/quantum/plugins/cisco/nexus/cisco_nexus_plugin_v2.py @@ -40,15 +40,11 @@ LOG = logging.getLogger(__name__) class NexusPlugin(L2DevicePluginBase): - """ - Nexus PLugIn Main Class - """ + """Nexus PlugIn Main Class.""" _networks = {} def __init__(self): - """ - Extracts the configuration parameters from the configuration file - """ + """Extract configuration parameters from the configuration file.""" self._client = importutils.import_object(conf.CISCO.nexus_driver) LOG.debug(_("Loaded driver %s"), conf.CISCO.nexus_driver) self._nexus_switches = conf.get_nexus_dictionary() @@ -65,9 +61,9 @@ class NexusPlugin(L2DevicePluginBase): return self.credentials[nexus_ip] def get_all_networks(self, tenant_id): - """ - Returns a dictionary containing all - for + """Get all networks. + + Returns a dictionary containing all for the specified tenant. """ LOG.debug(_("NexusPlugin:get_all_networks() called")) @@ -75,10 +71,10 @@ class NexusPlugin(L2DevicePluginBase): def create_network(self, tenant_id, net_name, net_id, vlan_name, vlan_id, host, instance): - """ - Create a VLAN in the appropriate switch/port, - and configure the appropriate interfaces - for this VLAN + """Create network. + + Create a VLAN in the appropriate switch/port, and configure the + appropriate interfaces for this VLAN. """ LOG.debug(_("NexusPlugin:create_network() called")) # Grab the switch IP and port for this host @@ -129,46 +125,44 @@ class NexusPlugin(L2DevicePluginBase): return new_net_dict def delete_network(self, tenant_id, net_id, **kwargs): - """ + """Delete network. + Deletes the VLAN in all switches, and removes the VLAN configuration - from the relevant interfaces + from the relevant interfaces. """ LOG.debug(_("NexusPlugin:delete_network() called")) def get_network_details(self, tenant_id, net_id, **kwargs): - """ - Returns the details of a particular network - """ + """Return the details of a particular network.""" LOG.debug(_("NexusPlugin:get_network_details() called")) network = self._get_network(tenant_id, net_id) return network def update_network(self, tenant_id, net_id, **kwargs): - """ - Updates the properties of a particular - Virtual Network. - """ + """Update the properties of a particular Virtual Network.""" LOG.debug(_("NexusPlugin:update_network() called")) def get_all_ports(self, tenant_id, net_id, **kwargs): - """ + """Get all ports. + This is probably not applicable to the Nexus plugin. Delete if not required. """ LOG.debug(_("NexusPlugin:get_all_ports() called")) def create_port(self, tenant_id, net_id, port_state, port_id, **kwargs): - """ + """Create port. + This is probably not applicable to the Nexus plugin. Delete if not required. """ LOG.debug(_("NexusPlugin:create_port() called")) def delete_port(self, device_id, vlan_id): - """ - Delete port bindings from the database and scan - whether the network is still required on - the interfaces trunked + """Delete port. + + Delete port bindings from the database and scan whether the network + is still required on the interfaces trunked. """ LOG.debug(_("NexusPlugin:delete_port() called")) # Delete DB row for this port @@ -198,14 +192,16 @@ class NexusPlugin(L2DevicePluginBase): return row['instance_id'] def update_port(self, tenant_id, net_id, port_id, port_state, **kwargs): - """ + """Update port. + This is probably not applicable to the Nexus plugin. Delete if not required. """ LOG.debug(_("NexusPlugin:update_port() called")) def get_port_details(self, tenant_id, net_id, port_id, **kwargs): - """ + """Get port details. + This is probably not applicable to the Nexus plugin. Delete if not required. """ @@ -213,14 +209,16 @@ class NexusPlugin(L2DevicePluginBase): def plug_interface(self, tenant_id, net_id, port_id, remote_interface_id, **kwargs): - """ + """Plug interfaces. + This is probably not applicable to the Nexus plugin. Delete if not required. """ LOG.debug(_("NexusPlugin:plug_interface() called")) def unplug_interface(self, tenant_id, net_id, port_id, **kwargs): - """ + """Unplug interface. + This is probably not applicable to the Nexus plugin. Delete if not required. """ @@ -228,16 +226,12 @@ class NexusPlugin(L2DevicePluginBase): def _get_vlan_id_for_network(self, tenant_id, network_id, context, base_plugin_ref): - """ - Obtain the VLAN ID given the Network ID - """ + """Obtain the VLAN ID given the Network ID.""" vlan = cdb.get_vlan_binding(network_id) return vlan.vlan_id def _get_network(self, tenant_id, network_id, context, base_plugin_ref): - """ - Gets the NETWORK ID - """ + """Get the Network ID.""" network = base_plugin_ref._get_network(context, network_id) if not network: raise exc.NetworkNotFound(net_id=network_id) diff --git a/quantum/plugins/cisco/tests/unit/test_cisco_extension.py b/quantum/plugins/cisco/tests/unit/test_cisco_extension.py index 04b72e067..7a8c5ef61 100644 --- a/quantum/plugins/cisco/tests/unit/test_cisco_extension.py +++ b/quantum/plugins/cisco/tests/unit/test_cisco_extension.py @@ -74,7 +74,6 @@ class ExtensionsTestApp(wsgi.Router): super(ExtensionsTestApp, self).__init__(mapper) def create_request(self, path, body, content_type, method='GET'): - """Test create request.""" LOG.debug("test_create_request - START") @@ -87,7 +86,6 @@ class ExtensionsTestApp(wsgi.Router): return req def _create_network(self, name=None): - """Test create network.""" LOG.debug("Creating network - START") @@ -107,7 +105,6 @@ class ExtensionsTestApp(wsgi.Router): return network_data['network']['id'] def _create_port(self, network_id, port_state): - """Test create port.""" LOG.debug("Creating port for network %s - START", network_id) @@ -153,7 +150,6 @@ class ExtensionsTestApp(wsgi.Router): class QosExtensionTest(base.BaseTestCase): def setUp(self): - """Set up function.""" super(QosExtensionTest, self).setUp() @@ -180,7 +176,6 @@ class QosExtensionTest(base.BaseTestCase): self._l2network_plugin = l2network_plugin.L2Network() def test_create_qos(self): - """Test create qos.""" LOG.debug("test_create_qos - START") @@ -199,7 +194,6 @@ class QosExtensionTest(base.BaseTestCase): LOG.debug("test_create_qos - END") def test_create_qosBADRequest(self): - """Test create qos bad request.""" LOG.debug("test_create_qosBADRequest - START") @@ -211,7 +205,6 @@ class QosExtensionTest(base.BaseTestCase): LOG.debug("test_create_qosBADRequest - END") def test_list_qoss(self): - """Test list qoss.""" LOG.debug("test_list_qoss - START") @@ -251,7 +244,6 @@ class QosExtensionTest(base.BaseTestCase): LOG.debug("test_list_qoss - END") def test_show_qos(self): - """Test show qos.""" LOG.debug("test_show_qos - START") @@ -275,7 +267,6 @@ class QosExtensionTest(base.BaseTestCase): LOG.debug("test_show_qos - END") def test_show_qosDNE(self, qos_id='100'): - """Test show qos does not exist.""" LOG.debug("test_show_qosDNE - START") @@ -286,7 +277,6 @@ class QosExtensionTest(base.BaseTestCase): LOG.debug("test_show_qosDNE - END") def test_update_qos(self): - """Test update qos.""" LOG.debug("test_update_qos - START") @@ -318,7 +308,6 @@ class QosExtensionTest(base.BaseTestCase): LOG.debug("test_update_qos - END") def test_update_qosDNE(self, qos_id='100'): - """Test update qos does not exist.""" LOG.debug("test_update_qosDNE - START") @@ -340,7 +329,6 @@ class QosExtensionTest(base.BaseTestCase): LOG.debug("test_update_qosDNE - END") def test_update_qosBADRequest(self): - """Test update qos bad request.""" LOG.debug("test_update_qosBADRequest - START") @@ -361,7 +349,6 @@ class QosExtensionTest(base.BaseTestCase): LOG.debug("test_update_qosBADRequest - END") def test_delete_qos(self): - """Test delte qos.""" LOG.debug("test_delete_qos - START") @@ -386,7 +373,6 @@ class QosExtensionTest(base.BaseTestCase): LOG.debug("test_delete_qos - END") def test_delete_qosDNE(self, qos_id='100'): - """Test delte qos does not exist.""" LOG.debug("test_delete_qosDNE - START") @@ -397,7 +383,6 @@ class QosExtensionTest(base.BaseTestCase): LOG.debug("test_delete_qosDNE - END") def tearDownQos(self, delete_profile_path): - """Tear Down Qos.""" self.test_app.delete(delete_profile_path) @@ -409,7 +394,6 @@ class QosExtensionTest(base.BaseTestCase): class CredentialExtensionTest(base.BaseTestCase): def setUp(self): - """Set up function.""" super(CredentialExtensionTest, self).setUp() @@ -434,7 +418,6 @@ class CredentialExtensionTest(base.BaseTestCase): self._l2network_plugin = l2network_plugin.L2Network() def test_list_credentials(self): - """Test list credentials.""" #Create Credential before listing @@ -479,7 +462,6 @@ class CredentialExtensionTest(base.BaseTestCase): LOG.debug("test_list_credentials - END") def test_create_credential(self): - """Test create credential.""" LOG.debug("test_create_credential - START") @@ -498,7 +480,6 @@ class CredentialExtensionTest(base.BaseTestCase): LOG.debug("test_create_credential - END") def test_create_credentialBADRequest(self): - """Test create credential bad request.""" LOG.debug("test_create_credentialBADRequest - START") @@ -509,7 +490,6 @@ class CredentialExtensionTest(base.BaseTestCase): LOG.debug("test_create_credentialBADRequest - END") def test_show_credential(self): - """Test show credential.""" LOG.debug("test_show_credential - START") @@ -534,7 +514,6 @@ class CredentialExtensionTest(base.BaseTestCase): LOG.debug("test_show_credential - END") def test_show_credentialDNE(self, credential_id='100'): - """Test show credential does not exist.""" LOG.debug("test_show_credentialDNE - START") @@ -545,7 +524,6 @@ class CredentialExtensionTest(base.BaseTestCase): LOG.debug("test_show_credentialDNE - END") def test_update_credential(self): - """Test update credential.""" LOG.debug("test_update_credential - START") @@ -581,7 +559,6 @@ class CredentialExtensionTest(base.BaseTestCase): LOG.debug("test_update_credential - END") def test_update_credBADReq(self): - """Test update credential bad request.""" LOG.debug("test_update_credBADReq - START") @@ -600,7 +577,6 @@ class CredentialExtensionTest(base.BaseTestCase): LOG.debug("test_update_credBADReq - END") def test_update_credentialDNE(self, credential_id='100'): - """Test update credential does not exist.""" LOG.debug("test_update_credentialDNE - START") @@ -620,7 +596,6 @@ class CredentialExtensionTest(base.BaseTestCase): LOG.debug("test_update_credentialDNE - END") def test_delete_credential(self): - """Test delete credential.""" LOG.debug("test_delete_credential - START") @@ -638,7 +613,6 @@ class CredentialExtensionTest(base.BaseTestCase): LOG.debug("test_delete_credential - END") def test_delete_credentialDNE(self, credential_id='100'): - """Test delete credential does not exist.""" LOG.debug("test_delete_credentialDNE - START") diff --git a/quantum/plugins/cisco/tests/unit/test_database.py b/quantum/plugins/cisco/tests/unit/test_database.py index fb054c510..4ff9e8a9a 100644 --- a/quantum/plugins/cisco/tests/unit/test_database.py +++ b/quantum/plugins/cisco/tests/unit/test_database.py @@ -32,8 +32,9 @@ LOG = logging.getLogger(__name__) class NexusDB(object): """Class consisting of methods to call nexus db methods.""" + def get_all_nexusportbindings(self): - """get all nexus port bindings.""" + """Get all nexus port bindings.""" bindings = [] try: for bind in nexus_db.get_all_nexusport_bindings(): @@ -47,7 +48,7 @@ class NexusDB(object): return bindings def get_nexusportbinding(self, vlan_id): - """get nexus port binding.""" + """Get nexus port binding.""" binding = [] try: for bind in nexus_db.get_nexusport_binding(vlan_id): @@ -61,7 +62,7 @@ class NexusDB(object): return binding def create_nexusportbinding(self, port_id, vlan_id): - """create nexus port binding.""" + """Create nexus port binding.""" bind_dict = {} try: res = nexus_db.add_nexusport_binding(port_id, vlan_id) @@ -73,7 +74,7 @@ class NexusDB(object): LOG.error("Failed to create nexus binding: %s" % str(exc)) def delete_nexusportbinding(self, vlan_id): - """delete nexus port binding.""" + """Delete nexus port binding.""" bindings = [] try: bind = nexus_db.remove_nexusport_binding(vlan_id) @@ -88,7 +89,7 @@ class NexusDB(object): % str(exc)) def update_nexusport_binding(self, port_id, new_vlan_id): - """update nexus port binding.""" + """Update nexus port binding.""" try: res = nexus_db.update_nexusport_binding(port_id, new_vlan_id) LOG.debug("Updating nexus port binding : %s" % res.port_id) @@ -354,13 +355,13 @@ class NexusDBTest(base.BaseTestCase): LOG.debug("Setup") def testa_create_nexusportbinding(self): - """create nexus port binding.""" + """Create nexus port binding.""" binding1 = self.dbtest.create_nexusportbinding("port1", 10) self.assertTrue(binding1["port-id"] == "port1") self.tearDown_nexusportbinding() def testb_getall_nexusportbindings(self): - """get all nexus port binding.""" + """Get all nexus port bindings.""" self.dbtest.create_nexusportbinding("port1", 10) self.dbtest.create_nexusportbinding("port2", 10) bindings = self.dbtest.get_all_nexusportbindings() @@ -372,7 +373,7 @@ class NexusDBTest(base.BaseTestCase): self.tearDown_nexusportbinding() def testc_delete_nexusportbinding(self): - """delete nexus port binding.""" + """Delete nexus port binding.""" self.dbtest.create_nexusportbinding("port1", 10) self.dbtest.delete_nexusportbinding(10) bindings = self.dbtest.get_all_nexusportbindings() @@ -384,7 +385,7 @@ class NexusDBTest(base.BaseTestCase): self.tearDown_nexusportbinding() def testd_update_nexusportbinding(self): - """update nexus port binding.""" + """Update nexus port binding.""" binding1 = self.dbtest.create_nexusportbinding("port1", 10) binding1 = self.dbtest.update_nexusport_binding(binding1["port-id"], 20) @@ -397,7 +398,7 @@ class NexusDBTest(base.BaseTestCase): self.tearDown_nexusportbinding() def tearDown_nexusportbinding(self): - """tear down nexusport binding table.""" + """Tear down nexus port binding table.""" LOG.debug("Tearing Down Nexus port Bindings") binds = self.dbtest.get_all_nexusportbindings() for bind in binds: @@ -417,7 +418,7 @@ class L2networkDBTest(base.BaseTestCase): LOG.debug("Setup") def testa_create_vlanbinding(self): - """test add vlan binding.""" + """Test add vlan binding.""" net1 = self.quantum.create_network("t1", "netid1") vlan1 = self.dbtest.create_vlan_binding(10, "vlan1", net1["net-id"]) self.assertTrue(vlan1["vlan-id"] == "10") @@ -425,7 +426,7 @@ class L2networkDBTest(base.BaseTestCase): self.teardown_network() def testb_getall_vlanbindings(self): - """test get all vlan binding.""" + """Test get all vlan bindings.""" net1 = self.quantum.create_network("t1", "netid1") net2 = self.quantum.create_network("t1", "netid2") vlan1 = self.dbtest.create_vlan_binding(10, "vlan1", net1["net-id"]) @@ -442,7 +443,7 @@ class L2networkDBTest(base.BaseTestCase): self.teardown_network() def testc_delete_vlanbinding(self): - """test delete vlan binding.""" + """Test delete vlan binding.""" net1 = self.quantum.create_network("t1", "netid1") vlan1 = self.dbtest.create_vlan_binding(10, "vlan1", net1["net-id"]) self.assertTrue(vlan1["vlan-id"] == "10") @@ -457,7 +458,7 @@ class L2networkDBTest(base.BaseTestCase): self.teardown_network() def testd_update_vlanbinding(self): - """test update vlan binding.""" + """Test update vlan binding.""" net1 = self.quantum.create_network("t1", "netid1") vlan1 = self.dbtest.create_vlan_binding(10, "vlan1", net1["net-id"]) self.assertTrue(vlan1["vlan-id"] == "10") @@ -472,7 +473,7 @@ class L2networkDBTest(base.BaseTestCase): self.teardown_network() def testm_test_vlanids(self): - """test vlanid methods.""" + """Test vlanid methods.""" l2network_db.create_vlanids() vlanids = l2network_db.get_all_vlanids() self.assertTrue(len(vlanids) > 0) @@ -523,13 +524,13 @@ class QuantumDBTest(base.BaseTestCase): LOG.debug("Setup") def testa_create_network(self): - """test to create network.""" + """Test to create network.""" net1 = self.dbtest.create_network(self.tenant_id, "plugin_test1") self.assertTrue(net1["net-name"] == "plugin_test1") self.teardown_network_port() def testb_get_networks(self): - """test to get all networks.""" + """Test to get all networks.""" net1 = self.dbtest.create_network(self.tenant_id, "plugin_test1") self.assertTrue(net1["net-name"] == "plugin_test1") net2 = self.dbtest.create_network(self.tenant_id, "plugin_test2") @@ -543,7 +544,7 @@ class QuantumDBTest(base.BaseTestCase): self.teardown_network_port() def testc_delete_network(self): - """test to delete network.""" + """Test to delete network.""" net1 = self.dbtest.create_network(self.tenant_id, "plugin_test1") self.assertTrue(net1["net-name"] == "plugin_test1") self.dbtest.delete_network(net1["net-id"]) @@ -556,7 +557,7 @@ class QuantumDBTest(base.BaseTestCase): self.teardown_network_port() def testd_update_network(self): - """test to update (rename) network.""" + """Test to update (rename) network.""" net1 = self.dbtest.create_network(self.tenant_id, "plugin_test1") self.assertTrue(net1["net-name"] == "plugin_test1") net = self.dbtest.update_network(self.tenant_id, net1["net-id"], @@ -565,7 +566,7 @@ class QuantumDBTest(base.BaseTestCase): self.teardown_network_port() def teste_create_port(self): - """test to create port.""" + """Test to create port.""" net1 = self.dbtest.create_network(self.tenant_id, "plugin_test1") port = self.dbtest.create_port(net1["net-id"]) self.assertTrue(port["net-id"] == net1["net-id"]) @@ -577,7 +578,7 @@ class QuantumDBTest(base.BaseTestCase): self.teardown_network_port() def testf_delete_port(self): - """test to delete port.""" + """Test to delete port.""" net1 = self.dbtest.create_network(self.tenant_id, "plugin_test1") port = self.dbtest.create_port(net1["net-id"]) self.assertTrue(port["net-id"] == net1["net-id"]) @@ -596,7 +597,7 @@ class QuantumDBTest(base.BaseTestCase): self.teardown_network_port() def testg_plug_unplug_interface(self): - """test to plug/unplug interface.""" + """Test to plug/unplug interface.""" net1 = self.dbtest.create_network(self.tenant_id, "plugin_test1") port1 = self.dbtest.create_port(net1["net-id"]) self.dbtest.plug_interface(net1["net-id"], port1["port-id"], "vif1.1") @@ -608,7 +609,7 @@ class QuantumDBTest(base.BaseTestCase): self.teardown_network_port() def testh_joined_test(self): - """test to get network and port.""" + """Test to get network and port.""" net1 = self.dbtest.create_network("t1", "net1") port1 = self.dbtest.create_port(net1["net-id"]) self.assertTrue(port1["net-id"] == net1["net-id"]) diff --git a/quantum/plugins/cisco/tests/unit/v2/nexus/fake_nexus_driver.py b/quantum/plugins/cisco/tests/unit/v2/nexus/fake_nexus_driver.py index 598f2b118..0841d363e 100644 --- a/quantum/plugins/cisco/tests/unit/v2/nexus/fake_nexus_driver.py +++ b/quantum/plugins/cisco/tests/unit/v2/nexus/fake_nexus_driver.py @@ -19,95 +19,87 @@ class CiscoNEXUSFakeDriver(): - """ - Nexus Driver Fake Class - """ + """Nexus Driver Fake Class.""" + def __init__(self): pass def nxos_connect(self, nexus_host, nexus_ssh_port, nexus_user, nexus_password): - """ - Makes the fake connection to the Nexus Switch - """ + """Make the fake connection to the Nexus Switch.""" pass def create_xml_snippet(self, cutomized_config): - """ - Creates the Proper XML structure for the Nexus Switch Configuration + """Create XML snippet. + + Creates the Proper XML structure for the Nexus Switch + Configuration. """ pass def enable_vlan(self, mgr, vlanid, vlanname): - """ - Creates a VLAN on Nexus Switch given the VLAN ID and Name - """ + """Create a VLAN on Nexus Switch given the VLAN ID and Name.""" pass def disable_vlan(self, mgr, vlanid): - """ - Delete a VLAN on Nexus Switch given the VLAN ID - """ + """Delete a VLAN on Nexus Switch given the VLAN ID.""" pass def enable_port_trunk(self, mgr, interface): - """ - Enables trunk mode an interface on Nexus Switch - """ + """Enable trunk mode an interface on Nexus Switch.""" pass def disable_switch_port(self, mgr, interface): - """ - Disables trunk mode an interface on Nexus Switch - """ + """Disable trunk mode an interface on Nexus Switch.""" pass def enable_vlan_on_trunk_int(self, mgr, interface, vlanid): - """ - Enables trunk mode vlan access an interface on Nexus Switch given - VLANID + """Enable vlan on trunk interface. + + Enable trunk mode vlan access an interface on Nexus Switch given + VLANID. """ pass def disable_vlan_on_trunk_int(self, mgr, interface, vlanid): - """ + """Disables vlan in trunk interface. + Enables trunk mode vlan access an interface on Nexus Switch given - VLANID + VLANID. """ pass def create_vlan(self, vlan_name, vlan_id, nexus_host, nexus_user, nexus_password, nexus_ports, nexus_ssh_port, vlan_ids): - """ + """Create VLAN and enable it on interface. + Creates a VLAN and Enable on trunk mode an interface on Nexus Switch - given the VLAN ID and Name and Interface Number + given the VLAN ID and Name and Interface Number. """ pass def delete_vlan(self, vlan_id, nexus_host, nexus_user, nexus_password, nexus_ports, nexus_ssh_port): - """ + """Delete VLAN. + Delete a VLAN and Disables trunk mode an interface on Nexus Switch - given the VLAN ID and Interface Number + given the VLAN ID and Interface Number. """ pass def build_vlans_cmd(self): - """ - Builds a string with all the VLANs on the same Switch - """ + """Build a string with all the VLANs on the same Switch.""" pass def add_vlan_int(self, vlan_id, nexus_host, nexus_user, nexus_password, nexus_ports, nexus_ssh_port, vlan_ids=None): - """ - Adds a vlan from interfaces on the Nexus switch given the VLAN ID - """ + """Add a vlan from interfaces on the Nexus switch given the VLAN ID.""" pass def remove_vlan_int(self, vlan_id, nexus_host, nexus_user, nexus_password, nexus_ports, nexus_ssh_port): - """ - Removes a vlan from interfaces on the Nexus switch given the VLAN ID + """Remove vlan from interfaces. + + Removes a vlan from interfaces on the Nexus switch given the VLAN ID. """ pass